C10H22BrNO2S — CID 83086909
1-bromo-N-(2,2-dimethylheptyl)methanesulfonamide (PubChem CID 83086909) has the molecular formula C10H22BrNO2S and a molecular weight of 300.26 g/mol. Its IUPAC name is 1-bromo-N-(2,2-dimethylheptyl)methanesulfonamide.
| Compound Name | 1-bromo-N-(2,2-dimethylheptyl)methanesulfonamide |
|---|---|
| PubChem CID | 83086909 |
| Molecular Formula | C10H22BrNO2S |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 1-bromo-N-(2,2-dimethylheptyl)methanesulfonamide |
| SMILES | CCCCCC(C)(C)CNS(=O)(=O)CBr |
| InChI | InChI=1S/C10H22BrNO2S/c1-4-5-6-7-10(2,3)8-12-15(13,14)9-11/h12H,4-9H2,1-3H3 |
| InChIKey | DBYIFWSHKGHQBA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|