C8H4BrF2N — CID 83086922
2-bromo-2-(2,3-difluorophenyl)acetonitrile (PubChem CID 83086922) has the molecular formula C8H4BrF2N and a molecular weight of 232.03 g/mol. Its IUPAC name is 2-bromo-2-(2,3-difluorophenyl)acetonitrile.
| Compound Name | 2-bromo-2-(2,3-difluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 83086922 |
| Molecular Formula | C8H4BrF2N |
| Molecular Weight | 232.03 g/mol |
| Exact Mass | 230.95 |
| IUPAC Name | 2-bromo-2-(2,3-difluorophenyl)acetonitrile |
| SMILES | N#CC(Br)c1cccc(F)c1F |
| InChI | InChI=1S/C8H4BrF2N/c9-6(4-12)5-2-1-3-7(10)8(5)11/h1-3,6H |
| InChIKey | GXMIAKFSVSJBRI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.03 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|