About 5-bromo-2-(3-tert-butyl-1-methylpyrazol-4-yl)-4,6-dichloropyrimidine
5-bromo-2-(3-tert-butyl-1-methylpyrazol-4-yl)-4,6-dichloropyrimidine (PubChem CID 83091448) has the molecular formula C12H13BrCl2N4
and a molecular weight of 364.07 g/mol. Its IUPAC name is 5-bromo-2-(3-tert-butyl-1-methylpyrazol-4-yl)-4,6-dichloropyrimidine.
Molecular Properties
| Compound Name | 5-bromo-2-(3-tert-butyl-1-methylpyrazol-4-yl)-4,6-dichloropyrimidine |
| PubChem CID | 83091448 |
| Molecular Formula | C12H13BrCl2N4 |
| Molecular Weight | 364.07 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 5-bromo-2-(3-tert-butyl-1-methylpyrazol-4-yl)-4,6-dichloropyrimidine |
| SMILES | Cn1cc(-c2nc(Cl)c(Br)c(Cl)n2)c(C(C)(C)C)n1 |
| InChI | InChI=1S/C12H13BrCl2N4/c1-12(2,3)8-6(5-19(4)18-8)11-16-9(14)7(13)10(15)17-11/h5H,1-4H3 |
| InChIKey | QIVCAIBQBWUDJZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.07 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-2-(3-tert-butyl-1-methylpyrazol-4-yl)-4,6-dichloropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(3-tert-butyl-1-methylpyrazol-4-yl)-4,6-dichloropyrimidine?
The IUPAC name of 5-bromo-2-(3-tert-butyl-1-methylpyrazol-4-yl)-4,6-dichloropyrimidine (CID 83091448) is 5-bromo-2-(3-tert-butyl-1-methylpyrazol-4-yl)-4,6-dichloropyrimidine.
What is the SMILES notation for 5-bromo-2-(3-tert-butyl-1-methylpyrazol-4-yl)-4,6-dichloropyrimidine?
The canonical SMILES for 5-bromo-2-(3-tert-butyl-1-methylpyrazol-4-yl)-4,6-dichloropyrimidine is Cn1cc(-c2nc(Cl)c(Br)c(Cl)n2)c(C(C)(C)C)n1.
What is the InChIKey of 5-bromo-2-(3-tert-butyl-1-methylpyrazol-4-yl)-4,6-dichloropyrimidine?
The InChIKey is QIVCAIBQBWUDJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrCl2N4/c1-12(2,3)8-6(5-19(4)18-8)11-16-9(14)7(13)10(15)17-11/h5H,1-4H3.
What are the key properties of 5-bromo-2-(3-tert-butyl-1-methylpyrazol-4-yl)-4,6-dichloropyrimidine?
5-bromo-2-(3-tert-butyl-1-methylpyrazol-4-yl)-4,6-dichloropyrimidine has a molecular weight of 364.07 g/mol, XLogP of 4.24, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(3-tert-butyl-1-methylpyrazol-4-yl)-4,6-dichloropyrimidine is sourced from PubChem (CID 83091448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).