C15H22IN5 — CID 83085350
2-(3-tert-butyl-1-methylpyrazol-4-yl)-N-ethyl-5-iodo-6-methylpyrimidin-4-amine (PubChem CID 83085350) has the molecular formula C15H22IN5 and a molecular weight of 399.28 g/mol. Its IUPAC name is 2-(3-tert-butyl-1-methylpyrazol-4-yl)-N-ethyl-5-iodo-6-methylpyrimidin-4-amine.
| Compound Name | 2-(3-tert-butyl-1-methylpyrazol-4-yl)-N-ethyl-5-iodo-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 83085350 |
| Molecular Formula | C15H22IN5 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 2-(3-tert-butyl-1-methylpyrazol-4-yl)-N-ethyl-5-iodo-6-methylpyrimidin-4-amine |
| SMILES | CCNc1nc(-c2cn(C)nc2C(C)(C)C)nc(C)c1I |
| InChI | InChI=1S/C15H22IN5/c1-7-17-14-11(16)9(2)18-13(19-14)10-8-21(6)20-12(10)15(3,4)5/h8H,7H2,1-6H3,(H,17,18,19) |
| InChIKey | YYMIFCXZCARRPH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|