C9H15IN4 — CID 66305717
4-N-ethyl-5-iodo-2-N,2-N,6-trimethylpyrimidine-2,4-diamine (PubChem CID 66305717) has the molecular formula C9H15IN4 and a molecular weight of 306.15 g/mol. Its IUPAC name is 4-N-ethyl-5-iodo-2-N,2-N,6-trimethylpyrimidine-2,4-diamine.
| Compound Name | 4-N-ethyl-5-iodo-2-N,2-N,6-trimethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 66305717 |
| Molecular Formula | C9H15IN4 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 4-N-ethyl-5-iodo-2-N,2-N,6-trimethylpyrimidine-2,4-diamine |
| SMILES | CCNc1nc(N(C)C)nc(C)c1I |
| InChI | InChI=1S/C9H15IN4/c1-5-11-8-7(10)6(2)12-9(13-8)14(3)4/h5H2,1-4H3,(H,11,12,13) |
| InChIKey | OTKQYYMQJGWFFQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|