C10H20N4O3 — CID 83095939
4-(5-hydrazinyl-5-oxopentan-2-yl)morpholine-3-carboxamide (PubChem CID 83095939) has the molecular formula C10H20N4O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-(5-hydrazinyl-5-oxopentan-2-yl)morpholine-3-carboxamide.
| Compound Name | 4-(5-hydrazinyl-5-oxopentan-2-yl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83095939 |
| Molecular Formula | C10H20N4O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 4-(5-hydrazinyl-5-oxopentan-2-yl)morpholine-3-carboxamide |
| SMILES | CC(CCC(=O)NN)N1CCOCC1C(N)=O |
| InChI | InChI=1S/C10H20N4O3/c1-7(2-3-9(15)13-12)14-4-5-17-6-8(14)10(11)16/h7-8H,2-6,12H2,1H3,(H2,11,16)(H,13,15) |
| InChIKey | IWMYIPJRNFJFLV-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|