C14H20N4O3 — CID 83096787
4-[5-(aminomethyl)pyridine-2-carbonyl]-N-ethylmorpholine-3-carboxamide (PubChem CID 83096787) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 4-[5-(aminomethyl)pyridine-2-carbonyl]-N-ethylmorpholine-3-carboxamide.
| Compound Name | 4-[5-(aminomethyl)pyridine-2-carbonyl]-N-ethylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83096787 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 4-[5-(aminomethyl)pyridine-2-carbonyl]-N-ethylmorpholine-3-carboxamide |
| SMILES | CCNC(=O)C1COCCN1C(=O)c1ccc(CN)cn1 |
| InChI | InChI=1S/C14H20N4O3/c1-2-16-13(19)12-9-21-6-5-18(12)14(20)11-4-3-10(7-15)8-17-11/h3-4,8,12H,2,5-7,9,15H2,1H3,(H,16,19) |
| InChIKey | ORNDIURXKODRPM-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |