C15H19ClN2O3 — CID 83098794
4-[3-(chloromethyl)benzoyl]-N-ethylmorpholine-3-carboxamide (PubChem CID 83098794) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is 4-[3-(chloromethyl)benzoyl]-N-ethylmorpholine-3-carboxamide.
| Compound Name | 4-[3-(chloromethyl)benzoyl]-N-ethylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83098794 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 4-[3-(chloromethyl)benzoyl]-N-ethylmorpholine-3-carboxamide |
| SMILES | CCNC(=O)C1COCCN1C(=O)c1cccc(CCl)c1 |
| InChI | InChI=1S/C15H19ClN2O3/c1-2-17-14(19)13-10-21-7-6-18(13)15(20)12-5-3-4-11(8-12)9-16/h3-5,8,13H,2,6-7,9-10H2,1H3,(H,17,19) |
| InChIKey | FLAAESZJPIQDRW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|