C14H17IN2O3 — CID 83100853
N-ethyl-4-(3-iodobenzoyl)morpholine-3-carboxamide (PubChem CID 83100853) has the molecular formula C14H17IN2O3 and a molecular weight of 388.21 g/mol. Its IUPAC name is N-ethyl-4-(3-iodobenzoyl)morpholine-3-carboxamide.
| Compound Name | N-ethyl-4-(3-iodobenzoyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83100853 |
| Molecular Formula | C14H17IN2O3 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | N-ethyl-4-(3-iodobenzoyl)morpholine-3-carboxamide |
| SMILES | CCNC(=O)C1COCCN1C(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C14H17IN2O3/c1-2-16-13(18)12-9-20-7-6-17(12)14(19)10-4-3-5-11(15)8-10/h3-5,8,12H,2,6-7,9H2,1H3,(H,16,18) |
| InChIKey | IERRKJZNIOAKNS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|