C10H13N3O3S — CID 83100296
N-methyl-4-(1,3-thiazole-4-carbonyl)morpholine-3-carboxamide (PubChem CID 83100296) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is N-methyl-4-(1,3-thiazole-4-carbonyl)morpholine-3-carboxamide.
| Compound Name | N-methyl-4-(1,3-thiazole-4-carbonyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83100296 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | N-methyl-4-(1,3-thiazole-4-carbonyl)morpholine-3-carboxamide |
| SMILES | CNC(=O)C1COCCN1C(=O)c1cscn1 |
| InChI | InChI=1S/C10H13N3O3S/c1-11-9(14)8-4-16-3-2-13(8)10(15)7-5-17-6-12-7/h5-6,8H,2-4H2,1H3,(H,11,14) |
| InChIKey | FLBNOEKPBXWJPQ-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |