C12H13Cl2N3O3 — CID 83097617
4-(5,6-dichloropyridine-3-carbonyl)-N-methylmorpholine-3-carboxamide (PubChem CID 83097617) has the molecular formula C12H13Cl2N3O3 and a molecular weight of 318.16 g/mol. Its IUPAC name is 4-(5,6-dichloropyridine-3-carbonyl)-N-methylmorpholine-3-carboxamide.
| Compound Name | 4-(5,6-dichloropyridine-3-carbonyl)-N-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83097617 |
| Molecular Formula | C12H13Cl2N3O3 |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 4-(5,6-dichloropyridine-3-carbonyl)-N-methylmorpholine-3-carboxamide |
| SMILES | CNC(=O)C1COCCN1C(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2N3O3/c1-15-11(18)9-6-20-3-2-17(9)12(19)7-4-8(13)10(14)16-5-7/h4-5,9H,2-3,6H2,1H3,(H,15,18) |
| InChIKey | BACVIIFKYSTVIN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|