C12H15N3O3S — CID 98894873
(3aR,6S,6aR)-N-methyl-4-(1,3-thiazole-4-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide (PubChem CID 98894873) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is (3aR,6S,6aR)-N-methyl-4-(1,3-thiazole-4-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide.
| Compound Name | (3aR,6S,6aR)-N-methyl-4-(1,3-thiazole-4-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
|---|---|
| PubChem CID | 98894873 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | (3aR,6S,6aR)-N-methyl-4-(1,3-thiazole-4-carbonyl)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-6-carboxamide |
| SMILES | CNC(=O)[C@H]1CN(C(=O)c2cscn2)[C@@H]2CCO[C@H]12 |
| InChI | InChI=1S/C12H15N3O3S/c1-13-11(16)7-4-15(9-2-3-18-10(7)9)12(17)8-5-19-6-14-8/h5-7,9-10H,2-4H2,1H3,(H,13,16)/t7-,9+,10+/m0/s1 |
| InChIKey | SJFTVLODHIJBJP-FXBDTBDDSA-N |
| XLogP | 0.12 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |