C10H7Cl2IN4O2 — CID 83101239
3,5-dichloro-2-iodo-N-(3-methoxy-1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 83101239) has the molecular formula C10H7Cl2IN4O2 and a molecular weight of 413.00 g/mol. Its IUPAC name is 3,5-dichloro-2-iodo-N-(3-methoxy-1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | 3,5-dichloro-2-iodo-N-(3-methoxy-1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 83101239 |
| Molecular Formula | C10H7Cl2IN4O2 |
| Molecular Weight | 413.00 g/mol |
| Exact Mass | 411.90 |
| IUPAC Name | 3,5-dichloro-2-iodo-N-(3-methoxy-1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | COc1n[nH]c(NC(=O)c2cc(Cl)cc(Cl)c2I)n1 |
| InChI | InChI=1S/C10H7Cl2IN4O2/c1-19-10-15-9(16-17-10)14-8(18)5-2-4(11)3-6(12)7(5)13/h2-3H,1H3,(H2,14,15,16,17,18) |
| InChIKey | FSTOFEDYWUNSIW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.00 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|