C9H19N3O4S — CID 83101327
4-(1-aminobutan-2-ylsulfonyl)morpholine-3-carboxamide (PubChem CID 83101327) has the molecular formula C9H19N3O4S and a molecular weight of 265.33 g/mol. Its IUPAC name is 4-(1-aminobutan-2-ylsulfonyl)morpholine-3-carboxamide.
| Compound Name | 4-(1-aminobutan-2-ylsulfonyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83101327 |
| Molecular Formula | C9H19N3O4S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-(1-aminobutan-2-ylsulfonyl)morpholine-3-carboxamide |
| SMILES | CCC(CN)S(=O)(=O)N1CCOCC1C(N)=O |
| InChI | InChI=1S/C9H19N3O4S/c1-2-7(5-10)17(14,15)12-3-4-16-6-8(12)9(11)13/h7-8H,2-6,10H2,1H3,(H2,11,13) |
| InChIKey | PCGRVKLAPPCKJL-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |