C11H17N3O2S — CID 83102015
4-(2-amino-1-thiophen-3-ylethyl)morpholine-3-carboxamide (PubChem CID 83102015) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 4-(2-amino-1-thiophen-3-ylethyl)morpholine-3-carboxamide.
| Compound Name | 4-(2-amino-1-thiophen-3-ylethyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83102015 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 4-(2-amino-1-thiophen-3-ylethyl)morpholine-3-carboxamide |
| SMILES | NCC(c1ccsc1)N1CCOCC1C(N)=O |
| InChI | InChI=1S/C11H17N3O2S/c12-5-9(8-1-4-17-7-8)14-2-3-16-6-10(14)11(13)15/h1,4,7,9-10H,2-3,5-6,12H2,(H2,13,15) |
| InChIKey | VTRAUPVFSNQYOA-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |