C13H18FN3O2 — CID 83102016
4-[2-amino-1-(3-fluorophenyl)ethyl]morpholine-3-carboxamide (PubChem CID 83102016) has the molecular formula C13H18FN3O2 and a molecular weight of 267.30 g/mol. Its IUPAC name is 4-[2-amino-1-(3-fluorophenyl)ethyl]morpholine-3-carboxamide.
| Compound Name | 4-[2-amino-1-(3-fluorophenyl)ethyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83102016 |
| Molecular Formula | C13H18FN3O2 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 4-[2-amino-1-(3-fluorophenyl)ethyl]morpholine-3-carboxamide |
| SMILES | NCC(c1cccc(F)c1)N1CCOCC1C(N)=O |
| InChI | InChI=1S/C13H18FN3O2/c14-10-3-1-2-9(6-10)11(7-15)17-4-5-19-8-12(17)13(16)18/h1-3,6,11-12H,4-5,7-8,15H2,(H2,16,18) |
| InChIKey | SVAGZFKTVYKRNF-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |