C13H18N4O3 — CID 83102345
4-[2-(4-aminoanilino)-2-oxoethyl]morpholine-3-carboxamide (PubChem CID 83102345) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-[2-(4-aminoanilino)-2-oxoethyl]morpholine-3-carboxamide.
| Compound Name | 4-[2-(4-aminoanilino)-2-oxoethyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83102345 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 4-[2-(4-aminoanilino)-2-oxoethyl]morpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1CC(=O)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C13H18N4O3/c14-9-1-3-10(4-2-9)16-12(18)7-17-5-6-20-8-11(17)13(15)19/h1-4,11H,5-8,14H2,(H2,15,19)(H,16,18) |
| InChIKey | GQQDNRKFVRTQSG-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|