About 4-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]morpholine-3-carboxamide
4-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]morpholine-3-carboxamide (PubChem CID 83096573) has the molecular formula C13H16N2O5
and a molecular weight of 280.28 g/mol. Its IUPAC name is 4-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]morpholine-3-carboxamide.
Molecular Properties
| Compound Name | 4-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]morpholine-3-carboxamide |
| PubChem CID | 83096573 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]morpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1CC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H16N2O5/c14-13(19)9-7-20-4-3-15(9)6-12(18)8-1-2-10(16)11(17)5-8/h1-2,5,9,16-17H,3-4,6-7H2,(H2,14,19) |
| InChIKey | IXFDZUZKFMYNCK-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]morpholine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]morpholine-3-carboxamide?
The IUPAC name of 4-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]morpholine-3-carboxamide (CID 83096573) is 4-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]morpholine-3-carboxamide.
What is the SMILES notation for 4-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]morpholine-3-carboxamide?
The canonical SMILES for 4-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]morpholine-3-carboxamide is NC(=O)C1COCCN1CC(=O)c1ccc(O)c(O)c1.
What is the InChIKey of 4-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]morpholine-3-carboxamide?
The InChIKey is IXFDZUZKFMYNCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O5/c14-13(19)9-7-20-4-3-15(9)6-12(18)8-1-2-10(16)11(17)5-8/h1-2,5,9,16-17H,3-4,6-7H2,(H2,14,19).
What are the key properties of 4-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]morpholine-3-carboxamide?
4-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]morpholine-3-carboxamide has a molecular weight of 280.28 g/mol, XLogP of -0.53, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]morpholine-3-carboxamide is sourced from PubChem (CID 83096573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).