C13H16N2O5 — CID 83096573
4-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]morpholine-3-carboxamide (PubChem CID 83096573) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 4-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]morpholine-3-carboxamide.
| Compound Name | 4-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83096573 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]morpholine-3-carboxamide |
| SMILES | NC(=O)C1COCCN1CC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H16N2O5/c14-13(19)9-7-20-4-3-15(9)6-12(18)8-1-2-10(16)11(17)5-8/h1-2,5,9,16-17H,3-4,6-7H2,(H2,14,19) |
| InChIKey | IXFDZUZKFMYNCK-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|