C12H24N4O3 — CID 83104052
N-ethyl-4-(3-hydrazinyl-2,2-dimethyl-3-oxopropyl)morpholine-3-carboxamide (PubChem CID 83104052) has the molecular formula C12H24N4O3 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-ethyl-4-(3-hydrazinyl-2,2-dimethyl-3-oxopropyl)morpholine-3-carboxamide.
| Compound Name | N-ethyl-4-(3-hydrazinyl-2,2-dimethyl-3-oxopropyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83104052 |
| Molecular Formula | C12H24N4O3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | N-ethyl-4-(3-hydrazinyl-2,2-dimethyl-3-oxopropyl)morpholine-3-carboxamide |
| SMILES | CCNC(=O)C1COCCN1CC(C)(C)C(=O)NN |
| InChI | InChI=1S/C12H24N4O3/c1-4-14-10(17)9-7-19-6-5-16(9)8-12(2,3)11(18)15-13/h9H,4-8,13H2,1-3H3,(H,14,17)(H,15,18) |
| InChIKey | ACXPQELEIACHSR-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|