C10H20N4O4 — CID 83105070
hydrazinyl 3-[3-(ethylcarbamoyl)morpholin-4-yl]propanoate (PubChem CID 83105070) has the molecular formula C10H20N4O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is hydrazinyl 3-[3-(ethylcarbamoyl)morpholin-4-yl]propanoate.
| Compound Name | hydrazinyl 3-[3-(ethylcarbamoyl)morpholin-4-yl]propanoate |
|---|---|
| PubChem CID | 83105070 |
| Molecular Formula | C10H20N4O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | hydrazinyl 3-[3-(ethylcarbamoyl)morpholin-4-yl]propanoate |
| SMILES | CCNC(=O)C1COCCN1CCC(=O)ONN |
| InChI | InChI=1S/C10H20N4O4/c1-2-12-10(16)8-7-17-6-5-14(8)4-3-9(15)18-13-11/h8,13H,2-7,11H2,1H3,(H,12,16) |
| InChIKey | FZWJMUVEQITBLY-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|