C14H23N3O4 — CID 83105143
4-(6-oxopiperidine-3-carbonyl)-N-propan-2-ylmorpholine-3-carboxamide (PubChem CID 83105143) has the molecular formula C14H23N3O4 and a molecular weight of 297.35 g/mol. Its IUPAC name is 4-(6-oxopiperidine-3-carbonyl)-N-propan-2-ylmorpholine-3-carboxamide.
| Compound Name | 4-(6-oxopiperidine-3-carbonyl)-N-propan-2-ylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 83105143 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 4-(6-oxopiperidine-3-carbonyl)-N-propan-2-ylmorpholine-3-carboxamide |
| SMILES | CC(C)NC(=O)C1COCCN1C(=O)C1CCC(=O)NC1 |
| InChI | InChI=1S/C14H23N3O4/c1-9(2)16-13(19)11-8-21-6-5-17(11)14(20)10-3-4-12(18)15-7-10/h9-11H,3-8H2,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | TVYMXUZNUUHUJV-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |