C14H16N2OS — CID 83107402
2-(4-phenyloxan-4-yl)-1,3-thiazol-4-amine (PubChem CID 83107402) has the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-(4-phenyloxan-4-yl)-1,3-thiazol-4-amine.
| Compound Name | 2-(4-phenyloxan-4-yl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 83107402 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2-(4-phenyloxan-4-yl)-1,3-thiazol-4-amine |
| SMILES | Nc1csc(C2(c3ccccc3)CCOCC2)n1 |
| InChI | InChI=1S/C14H16N2OS/c15-12-10-18-13(16-12)14(6-8-17-9-7-14)11-4-2-1-3-5-11/h1-5,10H,6-9,15H2 |
| InChIKey | FMYXKUZWZBAASI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |