About 2-(4-phenyloxan-4-yl)-1,3-thiazol-4-amine
2-(4-phenyloxan-4-yl)-1,3-thiazol-4-amine (PubChem CID 83107402) has the molecular formula C14H16N2OS
and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-(4-phenyloxan-4-yl)-1,3-thiazol-4-amine.
Molecular Properties
| Compound Name | 2-(4-phenyloxan-4-yl)-1,3-thiazol-4-amine |
| PubChem CID | 83107402 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2-(4-phenyloxan-4-yl)-1,3-thiazol-4-amine |
| SMILES | Nc1csc(C2(c3ccccc3)CCOCC2)n1 |
| InChI | InChI=1S/C14H16N2OS/c15-12-10-18-13(16-12)14(6-8-17-9-7-14)11-4-2-1-3-5-11/h1-5,10H,6-9,15H2 |
| InChIKey | FMYXKUZWZBAASI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-phenyloxan-4-yl)-1,3-thiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-phenyloxan-4-yl)-1,3-thiazol-4-amine?
The IUPAC name of 2-(4-phenyloxan-4-yl)-1,3-thiazol-4-amine (CID 83107402) is 2-(4-phenyloxan-4-yl)-1,3-thiazol-4-amine.
What is the SMILES notation for 2-(4-phenyloxan-4-yl)-1,3-thiazol-4-amine?
The canonical SMILES for 2-(4-phenyloxan-4-yl)-1,3-thiazol-4-amine is Nc1csc(C2(c3ccccc3)CCOCC2)n1.
What is the InChIKey of 2-(4-phenyloxan-4-yl)-1,3-thiazol-4-amine?
The InChIKey is FMYXKUZWZBAASI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2OS/c15-12-10-18-13(16-12)14(6-8-17-9-7-14)11-4-2-1-3-5-11/h1-5,10H,6-9,15H2.
What are the key properties of 2-(4-phenyloxan-4-yl)-1,3-thiazol-4-amine?
2-(4-phenyloxan-4-yl)-1,3-thiazol-4-amine has a molecular weight of 260.36 g/mol, XLogP of 2.82, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-phenyloxan-4-yl)-1,3-thiazol-4-amine is sourced from PubChem (CID 83107402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).