C20H18N2O3S — CID 59160922
4-[4-(4-pyridin-3-yl-1,3-thiazol-2-yl)oxan-4-yl]benzoic acid (PubChem CID 59160922) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is 4-[4-(4-pyridin-3-yl-1,3-thiazol-2-yl)oxan-4-yl]benzoic acid.
| Compound Name | 4-[4-(4-pyridin-3-yl-1,3-thiazol-2-yl)oxan-4-yl]benzoic acid |
|---|---|
| PubChem CID | 59160922 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 4-[4-(4-pyridin-3-yl-1,3-thiazol-2-yl)oxan-4-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(C2(c3nc(-c4cccnc4)cs3)CCOCC2)cc1 |
| InChI | InChI=1S/C20H18N2O3S/c23-18(24)14-3-5-16(6-4-14)20(7-10-25-11-8-20)19-22-17(13-26-19)15-2-1-9-21-12-15/h1-6,9,12-13H,7-8,10-11H2,(H,23,24) |
| InChIKey | VWNIJLABCCKZAP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |