About 3-[2-[(2-aminophenyl)methylsulfonylamino]ethyl]-1,1-dimethylurea
3-[2-[(2-aminophenyl)methylsulfonylamino]ethyl]-1,1-dimethylurea (PubChem CID 83107685) has the molecular formula C12H20N4O3S
and a molecular weight of 300.38 g/mol. Its IUPAC name is 3-[2-[(2-aminophenyl)methylsulfonylamino]ethyl]-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-[2-[(2-aminophenyl)methylsulfonylamino]ethyl]-1,1-dimethylurea |
| PubChem CID | 83107685 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 3-[2-[(2-aminophenyl)methylsulfonylamino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNS(=O)(=O)Cc1ccccc1N |
| InChI | InChI=1S/C12H20N4O3S/c1-16(2)12(17)14-7-8-15-20(18,19)9-10-5-3-4-6-11(10)13/h3-6,15H,7-9,13H2,1-2H3,(H,14,17) |
| InChIKey | XLPDHHGQUSOQDB-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[(2-aminophenyl)methylsulfonylamino]ethyl]-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(2-aminophenyl)methylsulfonylamino]ethyl]-1,1-dimethylurea?
The IUPAC name of 3-[2-[(2-aminophenyl)methylsulfonylamino]ethyl]-1,1-dimethylurea (CID 83107685) is 3-[2-[(2-aminophenyl)methylsulfonylamino]ethyl]-1,1-dimethylurea.
What is the SMILES notation for 3-[2-[(2-aminophenyl)methylsulfonylamino]ethyl]-1,1-dimethylurea?
The canonical SMILES for 3-[2-[(2-aminophenyl)methylsulfonylamino]ethyl]-1,1-dimethylurea is CN(C)C(=O)NCCNS(=O)(=O)Cc1ccccc1N.
What is the InChIKey of 3-[2-[(2-aminophenyl)methylsulfonylamino]ethyl]-1,1-dimethylurea?
The InChIKey is XLPDHHGQUSOQDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O3S/c1-16(2)12(17)14-7-8-15-20(18,19)9-10-5-3-4-6-11(10)13/h3-6,15H,7-9,13H2,1-2H3,(H,14,17).
What are the key properties of 3-[2-[(2-aminophenyl)methylsulfonylamino]ethyl]-1,1-dimethylurea?
3-[2-[(2-aminophenyl)methylsulfonylamino]ethyl]-1,1-dimethylurea has a molecular weight of 300.38 g/mol, XLogP of -0.04, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(2-aminophenyl)methylsulfonylamino]ethyl]-1,1-dimethylurea is sourced from PubChem (CID 83107685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).