C10H17N3O4S2 — CID 62020736
3-[(2-aminophenyl)methylsulfonylamino]propane-1-sulfonamide (PubChem CID 62020736) has the molecular formula C10H17N3O4S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 3-[(2-aminophenyl)methylsulfonylamino]propane-1-sulfonamide.
| Compound Name | 3-[(2-aminophenyl)methylsulfonylamino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 62020736 |
| Molecular Formula | C10H17N3O4S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 3-[(2-aminophenyl)methylsulfonylamino]propane-1-sulfonamide |
| SMILES | Nc1ccccc1CS(=O)(=O)NCCCS(N)(=O)=O |
| InChI | InChI=1S/C10H17N3O4S2/c11-10-5-2-1-4-9(10)8-19(16,17)13-6-3-7-18(12,14)15/h1-2,4-5,13H,3,6-8,11H2,(H2,12,14,15) |
| InChIKey | BZPYDZJHKVVJFU-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|