C11H13Cl2F2N — CID 83108581
N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]propan-2-amine (PubChem CID 83108581) has the molecular formula C11H13Cl2F2N and a molecular weight of 268.13 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]propan-2-amine.
| Compound Name | N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]propan-2-amine |
|---|---|
| PubChem CID | 83108581 |
| Molecular Formula | C11H13Cl2F2N |
| Molecular Weight | 268.13 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]propan-2-amine |
| SMILES | CC(C)NCC(F)(F)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2F2N/c1-7(2)16-6-11(14,15)8-3-4-9(12)10(13)5-8/h3-5,7,16H,6H2,1-2H3 |
| InChIKey | IQEUBJVYIULHSF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.13 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |