C10H11Cl2F2NO2S — CID 166376489
N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]ethanesulfonamide (PubChem CID 166376489) has the molecular formula C10H11Cl2F2NO2S and a molecular weight of 318.17 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]ethanesulfonamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 166376489 |
| Molecular Formula | C10H11Cl2F2NO2S |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 316.99 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-2,2-difluoroethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCC(F)(F)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H11Cl2F2NO2S/c1-2-18(16,17)15-6-10(13,14)7-3-4-8(11)9(12)5-7/h3-5,15H,2,6H2,1H3 |
| InChIKey | JMLACYMUNULRBM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |