C14H22FN3O2 — CID 83126729
[4-[3-amino-3-(5-fluoro-2-pyridinyl)propyl]-5-methylmorpholin-2-yl]methanol (PubChem CID 83126729) has the molecular formula C14H22FN3O2 and a molecular weight of 283.35 g/mol. Its IUPAC name is [4-[3-amino-3-(5-fluoro-2-pyridinyl)propyl]-5-methylmorpholin-2-yl]methanol.
| Compound Name | [4-[3-amino-3-(5-fluoro-2-pyridinyl)propyl]-5-methylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 83126729 |
| Molecular Formula | C14H22FN3O2 |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | [4-[3-amino-3-(5-fluoro-2-pyridinyl)propyl]-5-methylmorpholin-2-yl]methanol |
| SMILES | CC1COC(CO)CN1CCC(N)c1ccc(F)cn1 |
| InChI | InChI=1S/C14H22FN3O2/c1-10-9-20-12(8-19)7-18(10)5-4-13(16)14-3-2-11(15)6-17-14/h2-3,6,10,12-13,19H,4-5,7-9,16H2,1H3 |
| InChIKey | NTLPYJWZMFUBLC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 71.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |