C13H19BF3O- — CID 83134295
[4-(3,3-dimethylbutoxy)-2-methylphenyl]-trifluoroboranuide (PubChem CID 83134295) has the molecular formula C13H19BF3O- and a molecular weight of 259.10 g/mol. Its IUPAC name is [4-(3,3-dimethylbutoxy)-2-methylphenyl]-trifluoroboranuide.
| Compound Name | [4-(3,3-dimethylbutoxy)-2-methylphenyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 83134295 |
| Molecular Formula | C13H19BF3O- |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | [4-(3,3-dimethylbutoxy)-2-methylphenyl]-trifluoroboranuide |
| SMILES | Cc1cc(OCCC(C)(C)C)ccc1[B-](F)(F)F |
| InChI | InChI=1S/C13H19BF3O/c1-10-9-11(18-8-7-13(2,3)4)5-6-12(10)14(15,16)17/h5-6,9H,7-8H2,1-4H3/q-1 |
| InChIKey | IGFSHTFMWYKICA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|