C16H32N4 — CID 83139699
3,3-dimethyl-2-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]-N-propylbutan-1-amine (PubChem CID 83139699) has the molecular formula C16H32N4 and a molecular weight of 280.46 g/mol. Its IUPAC name is 3,3-dimethyl-2-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]-N-propylbutan-1-amine.
| Compound Name | 3,3-dimethyl-2-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 83139699 |
| Molecular Formula | C16H32N4 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | 3,3-dimethyl-2-[[2-(2-methylpropyl)-1,2,4-triazol-3-yl]methyl]-N-propylbutan-1-amine |
| SMILES | CCCNCC(Cc1ncnn1CC(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H32N4/c1-7-8-17-10-14(16(4,5)6)9-15-18-12-19-20(15)11-13(2)3/h12-14,17H,7-11H2,1-6H3 |
| InChIKey | LPUIPDUKIAGJCC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|