C12H22BrN3 — CID 83142306
5-[2-(bromomethyl)-3,3-dimethylbutyl]-1-propan-2-yl-1,2,4-triazole (PubChem CID 83142306) has the molecular formula C12H22BrN3 and a molecular weight of 288.23 g/mol. Its IUPAC name is 5-[2-(bromomethyl)-3,3-dimethylbutyl]-1-propan-2-yl-1,2,4-triazole.
| Compound Name | 5-[2-(bromomethyl)-3,3-dimethylbutyl]-1-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 83142306 |
| Molecular Formula | C12H22BrN3 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 5-[2-(bromomethyl)-3,3-dimethylbutyl]-1-propan-2-yl-1,2,4-triazole |
| SMILES | CC(C)n1ncnc1CC(CBr)C(C)(C)C |
| InChI | InChI=1S/C12H22BrN3/c1-9(2)16-11(14-8-15-16)6-10(7-13)12(3,4)5/h8-10H,6-7H2,1-5H3 |
| InChIKey | ZWSKXQJOAWEKOT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|