C13H30N2 — CID 83143771
2-ethyl-1-N-(2,3,3-trimethylbutyl)butane-1,2-diamine (PubChem CID 83143771) has the molecular formula C13H30N2 and a molecular weight of 214.40 g/mol. Its IUPAC name is 2-ethyl-1-N-(2,3,3-trimethylbutyl)butane-1,2-diamine.
| Compound Name | 2-ethyl-1-N-(2,3,3-trimethylbutyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 83143771 |
| Molecular Formula | C13H30N2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.24 |
| IUPAC Name | 2-ethyl-1-N-(2,3,3-trimethylbutyl)butane-1,2-diamine |
| SMILES | CCC(N)(CC)CNCC(C)C(C)(C)C |
| InChI | InChI=1S/C13H30N2/c1-7-13(14,8-2)10-15-9-11(3)12(4,5)6/h11,15H,7-10,14H2,1-6H3 |
| InChIKey | KJGDKOPFENNKKG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |