C13H13BrClN3OS — CID 83146255
5-bromo-2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methoxy]benzenecarbothioamide (PubChem CID 83146255) has the molecular formula C13H13BrClN3OS and a molecular weight of 374.69 g/mol. Its IUPAC name is 5-bromo-2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methoxy]benzenecarbothioamide.
| Compound Name | 5-bromo-2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 83146255 |
| Molecular Formula | C13H13BrClN3OS |
| Molecular Weight | 374.69 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | 5-bromo-2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methoxy]benzenecarbothioamide |
| SMILES | Cc1nn(C)c(COc2ccc(Br)cc2C(N)=S)c1Cl |
| InChI | InChI=1S/C13H13BrClN3OS/c1-7-12(15)10(18(2)17-7)6-19-11-4-3-8(14)5-9(11)13(16)20/h3-5H,6H2,1-2H3,(H2,16,20) |
| InChIKey | RYKCAAWPRPQQGQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.69 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|