C11H8ClNO3S — CID 83156055
2-[(4-chloro-1,3-thiazol-2-yl)oxy]-4-methylbenzoic acid (PubChem CID 83156055) has the molecular formula C11H8ClNO3S and a molecular weight of 269.71 g/mol. Its IUPAC name is 2-[(4-chloro-1,3-thiazol-2-yl)oxy]-4-methylbenzoic acid.
| Compound Name | 2-[(4-chloro-1,3-thiazol-2-yl)oxy]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 83156055 |
| Molecular Formula | C11H8ClNO3S |
| Molecular Weight | 269.71 g/mol |
| Exact Mass | 268.99 |
| IUPAC Name | 2-[(4-chloro-1,3-thiazol-2-yl)oxy]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)c(Oc2nc(Cl)cs2)c1 |
| InChI | InChI=1S/C11H8ClNO3S/c1-6-2-3-7(10(14)15)8(4-6)16-11-13-9(12)5-17-11/h2-5H,1H3,(H,14,15) |
| InChIKey | SKBOZKYIMFYPMT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.71 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |