3-[(4-chloro-1,3-thiazol-2-yl)oxy]pyridine-4-carboxylic acid

C9H5ClN2O3S — CID 83156671

IUPAC3-[(4-chloro-1,3-thiazol-2-yl)oxy]pyridine-4-carboxylic acid
SMILESO=C(O)c1ccncc1Oc1nc(Cl)cs1
InChIInChI=1S/C9H5ClN2O3S/c10-7-4-16-9(12-7)15-6-3-11-2-1-5(6)8(13)14/h1-4H,(H,13,14)
InChIKeyAWZYTHWIYYCMOS-UHFFFAOYSA-N
MW256.67 g/mol
LogP2.68
Rot. Bonds3

About 3-[(4-chloro-1,3-thiazol-2-yl)oxy]pyridine-4-carboxylic acid

3-[(4-chloro-1,3-thiazol-2-yl)oxy]pyridine-4-carboxylic acid (PubChem CID 83156671) has the molecular formula C9H5ClN2O3S and a molecular weight of 256.67 g/mol. Its IUPAC name is 3-[(4-chloro-1,3-thiazol-2-yl)oxy]pyridine-4-carboxylic acid.

Molecular Properties

Compound Name3-[(4-chloro-1,3-thiazol-2-yl)oxy]pyridine-4-carboxylic acid
PubChem CID83156671
Molecular FormulaC9H5ClN2O3S
Molecular Weight256.67 g/mol
Exact Mass255.97
IUPAC Name3-[(4-chloro-1,3-thiazol-2-yl)oxy]pyridine-4-carboxylic acid
SMILESO=C(O)c1ccncc1Oc1nc(Cl)cs1
InChIInChI=1S/C9H5ClN2O3S/c10-7-4-16-9(12-7)15-6-3-11-2-1-5(6)8(13)14/h1-4H,(H,13,14)
InChIKeyAWZYTHWIYYCMOS-UHFFFAOYSA-N
XLogP2.68
TPSA72.31 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.67
LogP ≤ 52.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-[(4-chloro-1,3-thiazol-2-yl)oxy]pyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(4-chloro-1,3-thiazol-2-yl)oxy]pyridine-4-carboxylic acid?
The IUPAC name of 3-[(4-chloro-1,3-thiazol-2-yl)oxy]pyridine-4-carboxylic acid (CID 83156671) is 3-[(4-chloro-1,3-thiazol-2-yl)oxy]pyridine-4-carboxylic acid.
What is the SMILES notation for 3-[(4-chloro-1,3-thiazol-2-yl)oxy]pyridine-4-carboxylic acid?
The canonical SMILES for 3-[(4-chloro-1,3-thiazol-2-yl)oxy]pyridine-4-carboxylic acid is O=C(O)c1ccncc1Oc1nc(Cl)cs1.
What is the InChIKey of 3-[(4-chloro-1,3-thiazol-2-yl)oxy]pyridine-4-carboxylic acid?
The InChIKey is AWZYTHWIYYCMOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClN2O3S/c10-7-4-16-9(12-7)15-6-3-11-2-1-5(6)8(13)14/h1-4H,(H,13,14).
What are the key properties of 3-[(4-chloro-1,3-thiazol-2-yl)oxy]pyridine-4-carboxylic acid?
3-[(4-chloro-1,3-thiazol-2-yl)oxy]pyridine-4-carboxylic acid has a molecular weight of 256.67 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-chloro-1,3-thiazol-2-yl)oxy]pyridine-4-carboxylic acid is sourced from PubChem (CID 83156671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).