C9H13ClN2S — CID 83156680
4-chloro-2-(4-methylpiperidin-1-yl)-1,3-thiazole (PubChem CID 83156680) has the molecular formula C9H13ClN2S and a molecular weight of 216.74 g/mol. Its IUPAC name is 4-chloro-2-(4-methylpiperidin-1-yl)-1,3-thiazole.
| Compound Name | 4-chloro-2-(4-methylpiperidin-1-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 83156680 |
| Molecular Formula | C9H13ClN2S |
| Molecular Weight | 216.74 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 4-chloro-2-(4-methylpiperidin-1-yl)-1,3-thiazole |
| SMILES | CC1CCN(c2nc(Cl)cs2)CC1 |
| InChI | InChI=1S/C9H13ClN2S/c1-7-2-4-12(5-3-7)9-11-8(10)6-13-9/h6-7H,2-5H2,1H3 |
| InChIKey | OAVBTHXOLGDXQZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.74 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |