C14H13N3O2S — CID 831625
5-amino-4-cyano-N-(2-methoxyphenyl)-3-methylthiophene-2-carboxamide (PubChem CID 831625) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is 5-amino-4-cyano-N-(2-methoxyphenyl)-3-methylthiophene-2-carboxamide.
| Compound Name | 5-amino-4-cyano-N-(2-methoxyphenyl)-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 831625 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 5-amino-4-cyano-N-(2-methoxyphenyl)-3-methylthiophene-2-carboxamide |
| SMILES | COc1ccccc1NC(=O)c1sc(N)c(C#N)c1C |
| InChI | InChI=1S/C14H13N3O2S/c1-8-9(7-15)13(16)20-12(8)14(18)17-10-5-3-4-6-11(10)19-2/h3-6H,16H2,1-2H3,(H,17,18) |
| InChIKey | DNAYOQWIEGYORL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |