C13H16O2S2 — CID 83173588
2-(2-phenylsulfanylethyl)thiolane-2-carboxylic acid (PubChem CID 83173588) has the molecular formula C13H16O2S2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-(2-phenylsulfanylethyl)thiolane-2-carboxylic acid.
| Compound Name | 2-(2-phenylsulfanylethyl)thiolane-2-carboxylic acid |
|---|---|
| PubChem CID | 83173588 |
| Molecular Formula | C13H16O2S2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 2-(2-phenylsulfanylethyl)thiolane-2-carboxylic acid |
| SMILES | O=C(O)C1(CCSc2ccccc2)CCCS1 |
| InChI | InChI=1S/C13H16O2S2/c14-12(15)13(7-4-9-17-13)8-10-16-11-5-2-1-3-6-11/h1-3,5-6H,4,7-10H2,(H,14,15) |
| InChIKey | SWWVYRGRPGVORV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |