C10H10F2N2O3S — CID 83174365
1-(difluoromethyl)-4-methoxyindole-3-sulfonamide (PubChem CID 83174365) has the molecular formula C10H10F2N2O3S and a molecular weight of 276.26 g/mol. Its IUPAC name is 1-(difluoromethyl)-4-methoxyindole-3-sulfonamide.
| Compound Name | 1-(difluoromethyl)-4-methoxyindole-3-sulfonamide |
|---|---|
| PubChem CID | 83174365 |
| Molecular Formula | C10H10F2N2O3S |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 1-(difluoromethyl)-4-methoxyindole-3-sulfonamide |
| SMILES | COc1cccc2c1c(S(N)(=O)=O)cn2C(F)F |
| InChI | InChI=1S/C10H10F2N2O3S/c1-17-7-4-2-3-6-9(7)8(18(13,15)16)5-14(6)10(11)12/h2-5,10H,1H3,(H2,13,15,16) |
| InChIKey | LFQINJMTDOJHFC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |