C9H9NO2S — CID 83175983
2-(furan-2-yl)-1-(1,3-thiazol-4-yl)ethanol (PubChem CID 83175983) has the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. Its IUPAC name is 2-(furan-2-yl)-1-(1,3-thiazol-4-yl)ethanol.
| Compound Name | 2-(furan-2-yl)-1-(1,3-thiazol-4-yl)ethanol |
|---|---|
| PubChem CID | 83175983 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 2-(furan-2-yl)-1-(1,3-thiazol-4-yl)ethanol |
| SMILES | OC(Cc1ccco1)c1cscn1 |
| InChI | InChI=1S/C9H9NO2S/c11-9(8-5-13-6-10-8)4-7-2-1-3-12-7/h1-3,5-6,9,11H,4H2 |
| InChIKey | SKHYOGVGSNIYTO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |