About N-[[2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methyl]-2-methylpropan-2-amine
N-[[2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methyl]-2-methylpropan-2-amine (PubChem CID 83185212) has the molecular formula C16H28N4
and a molecular weight of 276.43 g/mol. Its IUPAC name is N-[[2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methyl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[[2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methyl]-2-methylpropan-2-amine |
| PubChem CID | 83185212 |
| Molecular Formula | C16H28N4 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | N-[[2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methyl]-2-methylpropan-2-amine |
| SMILES | Cc1nc(N2CCCC2(C)C)ncc1CNC(C)(C)C |
| InChI | InChI=1S/C16H28N4/c1-12-13(11-18-15(2,3)4)10-17-14(19-12)20-9-7-8-16(20,5)6/h10,18H,7-9,11H2,1-6H3 |
| InChIKey | UVFMZNKMYSNWMQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methyl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methyl]-2-methylpropan-2-amine?
The IUPAC name of N-[[2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methyl]-2-methylpropan-2-amine (CID 83185212) is N-[[2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methyl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[[2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methyl]-2-methylpropan-2-amine?
The canonical SMILES for N-[[2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methyl]-2-methylpropan-2-amine is Cc1nc(N2CCCC2(C)C)ncc1CNC(C)(C)C.
What is the InChIKey of N-[[2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methyl]-2-methylpropan-2-amine?
The InChIKey is UVFMZNKMYSNWMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N4/c1-12-13(11-18-15(2,3)4)10-17-14(19-12)20-9-7-8-16(20,5)6/h10,18H,7-9,11H2,1-6H3.
What are the key properties of N-[[2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methyl]-2-methylpropan-2-amine?
N-[[2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methyl]-2-methylpropan-2-amine has a molecular weight of 276.43 g/mol, XLogP of 3.05, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(2,2-dimethylpyrrolidin-1-yl)-4-methylpyrimidin-5-yl]methyl]-2-methylpropan-2-amine is sourced from PubChem (CID 83185212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).