C10H13N3OS — CID 83190313
2-(oxolan-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine (PubChem CID 83190313) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 2-(oxolan-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine.
| Compound Name | 2-(oxolan-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 83190313 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 2-(oxolan-2-yl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1nc(C2CCCO2)nc2c1CSC2 |
| InChI | InChI=1S/C10H13N3OS/c11-9-6-4-15-5-7(6)12-10(13-9)8-2-1-3-14-8/h8H,1-5H2,(H2,11,12,13) |
| InChIKey | VHGVLTCNWMTKGL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |