C11H16N4S — CID 105498181
2-piperidin-3-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine (PubChem CID 105498181) has the molecular formula C11H16N4S and a molecular weight of 236.34 g/mol. Its IUPAC name is 2-piperidin-3-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine.
| Compound Name | 2-piperidin-3-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 105498181 |
| Molecular Formula | C11H16N4S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 2-piperidin-3-yl-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1nc(C2CCCNC2)nc2c1CSC2 |
| InChI | InChI=1S/C11H16N4S/c12-10-8-5-16-6-9(8)14-11(15-10)7-2-1-3-13-4-7/h7,13H,1-6H2,(H2,12,14,15) |
| InChIKey | WXNUXKQMFTWXAB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |