C11H16N4O — CID 105475953
2-piperidin-4-yl-5,7-dihydrofuro[3,4-d]pyrimidin-4-amine (PubChem CID 105475953) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 2-piperidin-4-yl-5,7-dihydrofuro[3,4-d]pyrimidin-4-amine.
| Compound Name | 2-piperidin-4-yl-5,7-dihydrofuro[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 105475953 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-piperidin-4-yl-5,7-dihydrofuro[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1nc(C2CCNCC2)nc2c1COC2 |
| InChI | InChI=1S/C11H16N4O/c12-10-8-5-16-6-9(8)14-11(15-10)7-1-3-13-4-2-7/h7,13H,1-6H2,(H2,12,14,15) |
| InChIKey | VUJXBWRIQCGKQT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |