C11H16N2O3S — CID 83200552
4-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol (PubChem CID 83200552) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 4-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol.
| Compound Name | 4-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol |
|---|---|
| PubChem CID | 83200552 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 4-[3-(oxan-3-yl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol |
| SMILES | OC1CSCC1c1nc(C2CCCOC2)no1 |
| InChI | InChI=1S/C11H16N2O3S/c14-9-6-17-5-8(9)11-12-10(13-16-11)7-2-1-3-15-4-7/h7-9,14H,1-6H2 |
| InChIKey | NWVOWAFKUKNCOK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |