C13H14FN3O3 — CID 83207625
2-amino-6-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-3-fluorobenzoic acid (PubChem CID 83207625) has the molecular formula C13H14FN3O3 and a molecular weight of 279.27 g/mol. Its IUPAC name is 2-amino-6-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-3-fluorobenzoic acid.
| Compound Name | 2-amino-6-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 83207625 |
| Molecular Formula | C13H14FN3O3 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-amino-6-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-3-fluorobenzoic acid |
| SMILES | Cc1noc(C)c1CNc1ccc(F)c(N)c1C(=O)O |
| InChI | InChI=1S/C13H14FN3O3/c1-6-8(7(2)20-17-6)5-16-10-4-3-9(14)12(15)11(10)13(18)19/h3-4,16H,5,15H2,1-2H3,(H,18,19) |
| InChIKey | LKYOKDBNSGZYAK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|