C18H23NO2 — CID 83211529
2-(3-phenoxypropyl)-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-ol (PubChem CID 83211529) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-(3-phenoxypropyl)-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-ol.
| Compound Name | 2-(3-phenoxypropyl)-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-ol |
|---|---|
| PubChem CID | 83211529 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2-(3-phenoxypropyl)-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-ol |
| SMILES | OC1CCCCc2cn(CCCOc3ccccc3)cc21 |
| InChI | InChI=1S/C18H23NO2/c20-18-10-5-4-7-15-13-19(14-17(15)18)11-6-12-21-16-8-2-1-3-9-16/h1-3,8-9,13-14,18,20H,4-7,10-12H2 |
| InChIKey | LSWZUWACSCMWRV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|