C13H12ClFN2O2S — CID 83215744
2-amino-6-[1-(5-chlorothiophen-2-yl)ethylamino]-3-fluorobenzoic acid (PubChem CID 83215744) has the molecular formula C13H12ClFN2O2S and a molecular weight of 314.77 g/mol. Its IUPAC name is 2-amino-6-[1-(5-chlorothiophen-2-yl)ethylamino]-3-fluorobenzoic acid.
| Compound Name | 2-amino-6-[1-(5-chlorothiophen-2-yl)ethylamino]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 83215744 |
| Molecular Formula | C13H12ClFN2O2S |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 2-amino-6-[1-(5-chlorothiophen-2-yl)ethylamino]-3-fluorobenzoic acid |
| SMILES | CC(Nc1ccc(F)c(N)c1C(=O)O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H12ClFN2O2S/c1-6(9-4-5-10(14)20-9)17-8-3-2-7(15)12(16)11(8)13(18)19/h2-6,17H,16H2,1H3,(H,18,19) |
| InChIKey | NFBXZDAUPUDMMG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|