C13H19NOS2 — CID 83229462
(6S)-N-cyclopentyloxy-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine (PubChem CID 83229462) has the molecular formula C13H19NOS2 and a molecular weight of 269.43 g/mol. Its IUPAC name is (6S)-N-cyclopentyloxy-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine.
| Compound Name | (6S)-N-cyclopentyloxy-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine |
|---|---|
| PubChem CID | 83229462 |
| Molecular Formula | C13H19NOS2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (6S)-N-cyclopentyloxy-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine |
| SMILES | C[C@H]1CC(NOC2CCCC2)c2ccsc2S1 |
| InChI | InChI=1S/C13H19NOS2/c1-9-8-12(11-6-7-16-13(11)17-9)14-15-10-4-2-3-5-10/h6-7,9-10,12,14H,2-5,8H2,1H3/t9-,12?/m0/s1 |
| InChIKey | VOAFLQORPUCCMG-QHGLUPRGSA-N |
| XLogP | 4.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|