C10H11BrClN5 — CID 83230500
N-[(3-bromo-4-chlorophenyl)methyl]-1-(2H-tetrazol-5-yl)ethanamine (PubChem CID 83230500) has the molecular formula C10H11BrClN5 and a molecular weight of 316.59 g/mol. Its IUPAC name is N-[(3-bromo-4-chlorophenyl)methyl]-1-(2H-tetrazol-5-yl)ethanamine.
| Compound Name | N-[(3-bromo-4-chlorophenyl)methyl]-1-(2H-tetrazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 83230500 |
| Molecular Formula | C10H11BrClN5 |
| Molecular Weight | 316.59 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | N-[(3-bromo-4-chlorophenyl)methyl]-1-(2H-tetrazol-5-yl)ethanamine |
| SMILES | CC(NCc1ccc(Cl)c(Br)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C10H11BrClN5/c1-6(10-14-16-17-15-10)13-5-7-2-3-9(12)8(11)4-7/h2-4,6,13H,5H2,1H3,(H,14,15,16,17) |
| InChIKey | KXPZVSXBQCPVGJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.59 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |